About 2-cyclobutylmorpholine
2-cyclobutylmorpholine (PubChem CID 54095871) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 2-cyclobutylmorpholine.
Molecular Properties
| Compound Name | 2-cyclobutylmorpholine |
| PubChem CID | 54095871 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2-cyclobutylmorpholine |
| SMILES | C1CC(C2CNCCO2)C1 |
| InChI | InChI=1S/C8H15NO/c1-2-7(3-1)8-6-9-4-5-10-8/h7-9H,1-6H2 |
| InChIKey | YTPPDLPMYCHVGL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclobutylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylmorpholine?
The IUPAC name of 2-cyclobutylmorpholine (CID 54095871) is 2-cyclobutylmorpholine.
What is the SMILES notation for 2-cyclobutylmorpholine?
The canonical SMILES for 2-cyclobutylmorpholine is C1CC(C2CNCCO2)C1.
What is the InChIKey of 2-cyclobutylmorpholine?
The InChIKey is YTPPDLPMYCHVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-2-7(3-1)8-6-9-4-5-10-8/h7-9H,1-6H2.
What are the key properties of 2-cyclobutylmorpholine?
2-cyclobutylmorpholine has a molecular weight of 141.21 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylmorpholine is sourced from PubChem (CID 54095871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).