About 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate
3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate (PubChem CID 54095950) has the molecular formula C19H20O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate.
Molecular Properties
| Compound Name | 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate |
| PubChem CID | 54095950 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate |
| SMILES | O=C(CCC1CC1)OCC=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C19H20O2/c20-19(13-12-15-10-11-15)21-14-4-8-17-7-3-6-16-5-1-2-9-18(16)17/h1-9,15H,10-14H2 |
| InChIKey | MXCJEJBKFKQPHR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate?
The IUPAC name of 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate (CID 54095950) is 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate.
What is the SMILES notation for 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate?
The canonical SMILES for 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate is O=C(CCC1CC1)OCC=Cc1cccc2ccccc12.
What is the InChIKey of 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate?
The InChIKey is MXCJEJBKFKQPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2/c20-19(13-12-15-10-11-15)21-14-4-8-17-7-3-6-16-5-1-2-9-18(16)17/h1-9,15H,10-14H2.
What are the key properties of 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate?
3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate has a molecular weight of 280.37 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-1-ylprop-2-enyl 3-cyclopropylpropanoate is sourced from PubChem (CID 54095950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).