About 5-methyldodec-1-enyl dihydrogen phosphate
5-methyldodec-1-enyl dihydrogen phosphate (PubChem CID 54096634) has the molecular formula C13H27O4P
and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-methyldodec-1-enyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 5-methyldodec-1-enyl dihydrogen phosphate |
| PubChem CID | 54096634 |
| Molecular Formula | C13H27O4P |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 5-methyldodec-1-enyl dihydrogen phosphate |
| SMILES | CCCCCCCC(C)CCC=COP(=O)(O)O |
| InChI | InChI=1S/C13H27O4P/c1-3-4-5-6-7-10-13(2)11-8-9-12-17-18(14,15)16/h9,12-13H,3-8,10-11H2,1-2H3,(H2,14,15,16) |
| InChIKey | MXOJCPNXFMLAQN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-methyldodec-1-enyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyldodec-1-enyl dihydrogen phosphate?
The IUPAC name of 5-methyldodec-1-enyl dihydrogen phosphate (CID 54096634) is 5-methyldodec-1-enyl dihydrogen phosphate.
What is the SMILES notation for 5-methyldodec-1-enyl dihydrogen phosphate?
The canonical SMILES for 5-methyldodec-1-enyl dihydrogen phosphate is CCCCCCCC(C)CCC=COP(=O)(O)O.
What is the InChIKey of 5-methyldodec-1-enyl dihydrogen phosphate?
The InChIKey is MXOJCPNXFMLAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27O4P/c1-3-4-5-6-7-10-13(2)11-8-9-12-17-18(14,15)16/h9,12-13H,3-8,10-11H2,1-2H3,(H2,14,15,16).
What are the key properties of 5-methyldodec-1-enyl dihydrogen phosphate?
5-methyldodec-1-enyl dihydrogen phosphate has a molecular weight of 278.33 g/mol, XLogP of 4.39, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyldodec-1-enyl dihydrogen phosphate is sourced from PubChem (CID 54096634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).