About 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate
2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate (PubChem CID 54097383) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate |
| PubChem CID | 54097383 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate |
| SMILES | C=CCOC1OOC1(C)OC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C12H20O6/c1-6-8-14-9-12(5,18-17-9)16-10(13)15-11(3,4)7-2/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | MYBPMFQAQZIAJB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate?
The IUPAC name of 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate (CID 54097383) is 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate.
What is the SMILES notation for 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate?
The canonical SMILES for 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate is C=CCOC1OOC1(C)OC(=O)OC(C)(C)CC.
What is the InChIKey of 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate?
The InChIKey is MYBPMFQAQZIAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c1-6-8-14-9-12(5,18-17-9)16-10(13)15-11(3,4)7-2/h6,9H,1,7-8H2,2-5H3.
What are the key properties of 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate?
2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate has a molecular weight of 260.29 g/mol, XLogP of 2.53, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl (3-methyl-4-prop-2-enoxydioxetan-3-yl) carbonate is sourced from PubChem (CID 54097383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).