C20H15N3O3 — CID 5409746
2-[(1-methyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]benzoic acid (PubChem CID 5409746) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[(1-methyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(1-methyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 5409746 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[(1-methyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]benzoic acid |
| SMILES | Cc1nc(C(=O)Nc2ccccc2C(=O)O)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C20H15N3O3/c1-11-18-14(12-6-2-4-8-15(12)22-18)10-17(21-11)19(24)23-16-9-5-3-7-13(16)20(25)26/h2-10,22H,1H3,(H,23,24)(H,25,26) |
| InChIKey | JXKKWYPQTJBSEX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |