About cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate
cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate (PubChem CID 54097697) has the molecular formula C16H20ClN3O2
and a molecular weight of 321.81 g/mol. Its IUPAC name is cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate.
Molecular Properties
| Compound Name | cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate |
| PubChem CID | 54097697 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate |
| SMILES | CCc1cc(C(=O)OCC2CC2)cc(Cl)c1NC1=NCCN1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-2-11-7-12(15(21)22-9-10-3-4-10)8-13(17)14(11)20-16-18-5-6-19-16/h7-8,10H,2-6,9H2,1H3,(H2,18,19,20) |
| InChIKey | MYHNSMFFPPQHOL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate?
The IUPAC name of cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate (CID 54097697) is cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate.
What is the SMILES notation for cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate?
The canonical SMILES for cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate is CCc1cc(C(=O)OCC2CC2)cc(Cl)c1NC1=NCCN1.
What is the InChIKey of cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate?
The InChIKey is MYHNSMFFPPQHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3O2/c1-2-11-7-12(15(21)22-9-10-3-4-10)8-13(17)14(11)20-16-18-5-6-19-16/h7-8,10H,2-6,9H2,1H3,(H2,18,19,20).
What are the key properties of cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate?
cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate has a molecular weight of 321.81 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 3-chloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-5-ethylbenzoate is sourced from PubChem (CID 54097697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).