C28H45NO4S — CID 54097984
2-[2,2-dimethyl-4-(2-methyl-1,3-thiazol-4-yl)-1,3-dioxan-4-yl]-5-hydroxy-2,6,10-trimethylpentadeca-10,14-dien-3-one (PubChem CID 54097984) has the molecular formula C28H45NO4S and a molecular weight of 491.74 g/mol. Its IUPAC name is 2-[2,2-dimethyl-4-(2-methyl-1,3-thiazol-4-yl)-1,3-dioxan-4-yl]-5-hydroxy-2,6,10-trimethylpentadeca-10,14-dien-3-one.
| Compound Name | 2-[2,2-dimethyl-4-(2-methyl-1,3-thiazol-4-yl)-1,3-dioxan-4-yl]-5-hydroxy-2,6,10-trimethylpentadeca-10,14-dien-3-one |
|---|---|
| PubChem CID | 54097984 |
| Molecular Formula | C28H45NO4S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | 2-[2,2-dimethyl-4-(2-methyl-1,3-thiazol-4-yl)-1,3-dioxan-4-yl]-5-hydroxy-2,6,10-trimethylpentadeca-10,14-dien-3-one |
| SMILES | C=CCCC=C(C)CCCC(C)C(O)CC(=O)C(C)(C)C1(c2csc(C)n2)CCOC(C)(C)O1 |
| InChI | InChI=1S/C28H45NO4S/c1-9-10-11-13-20(2)14-12-15-21(3)23(30)18-25(31)26(5,6)28(24-19-34-22(4)29-24)16-17-32-27(7,8)33-28/h9,13,19,21,23,30H,1,10-12,14-18H2,2-8H3 |
| InChIKey | MYMUQFIGWIBPRT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|