About 3-methyl-N-octyl-1,2-thiazole-5-carboxamide
3-methyl-N-octyl-1,2-thiazole-5-carboxamide (PubChem CID 54098021) has the molecular formula C13H22N2OS
and a molecular weight of 254.40 g/mol. Its IUPAC name is 3-methyl-N-octyl-1,2-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-N-octyl-1,2-thiazole-5-carboxamide |
| PubChem CID | 54098021 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-methyl-N-octyl-1,2-thiazole-5-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1cc(C)ns1 |
| InChI | InChI=1S/C13H22N2OS/c1-3-4-5-6-7-8-9-14-13(16)12-10-11(2)15-17-12/h10H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | MYNKHKMMCPQUCI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-octyl-1,2-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-octyl-1,2-thiazole-5-carboxamide?
The IUPAC name of 3-methyl-N-octyl-1,2-thiazole-5-carboxamide (CID 54098021) is 3-methyl-N-octyl-1,2-thiazole-5-carboxamide.
What is the SMILES notation for 3-methyl-N-octyl-1,2-thiazole-5-carboxamide?
The canonical SMILES for 3-methyl-N-octyl-1,2-thiazole-5-carboxamide is CCCCCCCCNC(=O)c1cc(C)ns1.
What is the InChIKey of 3-methyl-N-octyl-1,2-thiazole-5-carboxamide?
The InChIKey is MYNKHKMMCPQUCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2OS/c1-3-4-5-6-7-8-9-14-13(16)12-10-11(2)15-17-12/h10H,3-9H2,1-2H3,(H,14,16).
What are the key properties of 3-methyl-N-octyl-1,2-thiazole-5-carboxamide?
3-methyl-N-octyl-1,2-thiazole-5-carboxamide has a molecular weight of 254.40 g/mol, XLogP of 3.54, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-octyl-1,2-thiazole-5-carboxamide is sourced from PubChem (CID 54098021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).