C15H21F3N2O5S — CID 54098205
(2S)-1-[2-(acetylsulfanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54098205) has the molecular formula C15H21F3N2O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is (2S)-1-[2-(acetylsulfanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(acetylsulfanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54098205 |
| Molecular Formula | C15H21F3N2O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (2S)-1-[2-(acetylsulfanylmethyl)-5-[(2,2,2-trifluoroacetyl)amino]pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)SCC(CCCNC(=O)C(F)(F)F)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C15H21F3N2O5S/c1-9(21)26-8-10(4-2-6-19-14(25)15(16,17)18)12(22)20-7-3-5-11(20)13(23)24/h10-11H,2-8H2,1H3,(H,19,25)(H,23,24)/t10?,11-/m0/s1 |
| InChIKey | MYQNRRHMYCZFGP-DTIOYNMSSA-N |
| XLogP | 1.42 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|