C24H39NO — CID 54098260
N-icosa-5,8,11,14-tetraenylcyclopropanecarboxamide (PubChem CID 54098260) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is N-icosa-5,8,11,14-tetraenylcyclopropanecarboxamide.
| Compound Name | N-icosa-5,8,11,14-tetraenylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 54098260 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | N-icosa-5,8,11,14-tetraenylcyclopropanecarboxamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCNC(=O)C1CC1 |
| InChI | InChI=1S/C24H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-25-24(26)23-20-21-23/h6-7,9-10,12-13,15-16,23H,2-5,8,11,14,17-22H2,1H3,(H,25,26) |
| InChIKey | MYRSSBKXMNZAPQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|