About 3-methoxyprop-2-ynoic acid
3-methoxyprop-2-ynoic acid (PubChem CID 54098412) has the molecular formula C4H4O3
and a molecular weight of 100.07 g/mol. Its IUPAC name is 3-methoxyprop-2-ynoic acid.
Molecular Properties
| Compound Name | 3-methoxyprop-2-ynoic acid |
| PubChem CID | 54098412 |
| Molecular Formula | C4H4O3 |
| Molecular Weight | 100.07 g/mol |
| Exact Mass | 100.02 |
| IUPAC Name | 3-methoxyprop-2-ynoic acid |
| SMILES | COC#CC(=O)O |
| InChI | InChI=1S/C4H4O3/c1-7-3-2-4(5)6/h1H3,(H,5,6) |
| InChIKey | BTENHIPLBPAEIX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.07 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxyprop-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyprop-2-ynoic acid?
The IUPAC name of 3-methoxyprop-2-ynoic acid (CID 54098412) is 3-methoxyprop-2-ynoic acid.
What is the SMILES notation for 3-methoxyprop-2-ynoic acid?
The canonical SMILES for 3-methoxyprop-2-ynoic acid is COC#CC(=O)O.
What is the InChIKey of 3-methoxyprop-2-ynoic acid?
The InChIKey is BTENHIPLBPAEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O3/c1-7-3-2-4(5)6/h1H3,(H,5,6).
What are the key properties of 3-methoxyprop-2-ynoic acid?
3-methoxyprop-2-ynoic acid has a molecular weight of 100.07 g/mol, XLogP of -0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyprop-2-ynoic acid is sourced from PubChem (CID 54098412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).