About 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline
3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline (PubChem CID 54098537) has the molecular formula C19H18N6S
and a molecular weight of 362.46 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline.
Molecular Properties
| Compound Name | 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline |
| PubChem CID | 54098537 |
| Molecular Formula | C19H18N6S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline |
| SMILES | C(=Cc1nc2ccccc2s1)c1cccc(NCCCc2nn[nH]n2)c1 |
| InChI | InChI=1S/C19H18N6S/c1-2-8-17-16(7-1)21-19(26-17)11-10-14-5-3-6-15(13-14)20-12-4-9-18-22-24-25-23-18/h1-3,5-8,10-11,13,20H,4,9,12H2,(H,22,23,24,25) |
| InChIKey | MYWUPLGVFCSEOG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline?
The IUPAC name of 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline (CID 54098537) is 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline.
What is the SMILES notation for 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline?
The canonical SMILES for 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline is C(=Cc1nc2ccccc2s1)c1cccc(NCCCc2nn[nH]n2)c1.
What is the InChIKey of 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline?
The InChIKey is MYWUPLGVFCSEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6S/c1-2-8-17-16(7-1)21-19(26-17)11-10-14-5-3-6-15(13-14)20-12-4-9-18-22-24-25-23-18/h1-3,5-8,10-11,13,20H,4,9,12H2,(H,22,23,24,25).
What are the key properties of 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline?
3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline has a molecular weight of 362.46 g/mol, XLogP of 4.02, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,3-benzothiazol-2-yl)ethenyl]-N-[3-(2H-tetrazol-5-yl)propyl]aniline is sourced from PubChem (CID 54098537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).