About N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide
N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide (PubChem CID 54098815) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide.
Molecular Properties
| Compound Name | N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide |
| PubChem CID | 54098815 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide |
| SMILES | CNC(=S)c1[nH]c(=O)[nH]c1C |
| InChI | InChI=1S/C6H9N3OS/c1-3-4(5(11)7-2)9-6(10)8-3/h1-2H3,(H,7,11)(H2,8,9,10) |
| InChIKey | MZBZWVWCICOBCS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide?
The IUPAC name of N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide (CID 54098815) is N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide.
What is the SMILES notation for N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide?
The canonical SMILES for N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide is CNC(=S)c1[nH]c(=O)[nH]c1C.
What is the InChIKey of N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide?
The InChIKey is MZBZWVWCICOBCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c1-3-4(5(11)7-2)9-6(10)8-3/h1-2H3,(H,7,11)(H2,8,9,10).
What are the key properties of N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide?
N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide has a molecular weight of 171.22 g/mol, XLogP of -0.09, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-2-oxo-1,3-dihydroimidazole-4-carbothioamide is sourced from PubChem (CID 54098815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).