C40H37F2N6+ — CID 54099026
5-fluoro-3-[2-[1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-4-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole (PubChem CID 54099026) has the molecular formula C40H37F2N6+ and a molecular weight of 639.77 g/mol. Its IUPAC name is 5-fluoro-3-[2-[1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-4-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole.
| Compound Name | 5-fluoro-3-[2-[1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-4-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 54099026 |
| Molecular Formula | C40H37F2N6+ |
| Molecular Weight | 639.77 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | 5-fluoro-3-[2-[1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4,4-bis(1H-indol-4-yl)piperazin-4-ium-2-yl]ethyl]-1H-indole |
| SMILES | Fc1ccc2[nH]cc(CCC3C[N+](c4cccc5[nH]ccc45)(c4cccc5[nH]ccc45)CCN3CCc3c[nH]c4ccc(F)cc34)c2c1 |
| InChI | InChI=1S/C40H37F2N6/c41-28-8-11-37-33(21-28)26(23-45-37)7-10-30-25-48(39-5-1-3-35-31(39)13-16-43-35,40-6-2-4-36-32(40)14-17-44-36)20-19-47(30)18-15-27-24-46-38-12-9-29(42)22-34(27)38/h1-6,8-9,11-14,16-17,21-24,30,43-46H,7,10,15,18-20,25H2/q+1 |
| InChIKey | HKNBGYYXCZDXDA-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.77 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|