C30H15F9O6 — CID 54099445
[4-[3,5-bis[4-(2,2,2-trifluoroacetyl)oxyphenyl]phenyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 54099445) has the molecular formula C30H15F9O6 and a molecular weight of 642.43 g/mol. Its IUPAC name is [4-[3,5-bis[4-(2,2,2-trifluoroacetyl)oxyphenyl]phenyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[3,5-bis[4-(2,2,2-trifluoroacetyl)oxyphenyl]phenyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54099445 |
| Molecular Formula | C30H15F9O6 |
| Molecular Weight | 642.43 g/mol |
| Exact Mass | 642.07 |
| IUPAC Name | [4-[3,5-bis[4-(2,2,2-trifluoroacetyl)oxyphenyl]phenyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc(-c2cc(-c3ccc(OC(=O)C(F)(F)F)cc3)cc(-c3ccc(OC(=O)C(F)(F)F)cc3)c2)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H15F9O6/c31-28(32,33)25(40)43-22-7-1-16(2-8-22)19-13-20(17-3-9-23(10-4-17)44-26(41)29(34,35)36)15-21(14-19)18-5-11-24(12-6-18)45-27(42)30(37,38)39/h1-15H |
| InChIKey | MZNBOZIDDWLPJE-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.43 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|