About N-methoxy-4,7-dimethyloct-6-en-3-imine
N-methoxy-4,7-dimethyloct-6-en-3-imine (PubChem CID 54099560) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is N-methoxy-4,7-dimethyloct-6-en-3-imine.
Molecular Properties
| Compound Name | N-methoxy-4,7-dimethyloct-6-en-3-imine |
| PubChem CID | 54099560 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-methoxy-4,7-dimethyloct-6-en-3-imine |
| SMILES | CCC(=NOC)C(C)CC=C(C)C |
| InChI | InChI=1S/C11H21NO/c1-6-11(12-13-5)10(4)8-7-9(2)3/h7,10H,6,8H2,1-5H3 |
| InChIKey | MZPHHSIAUHKATE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-4,7-dimethyloct-6-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-4,7-dimethyloct-6-en-3-imine?
The IUPAC name of N-methoxy-4,7-dimethyloct-6-en-3-imine (CID 54099560) is N-methoxy-4,7-dimethyloct-6-en-3-imine.
What is the SMILES notation for N-methoxy-4,7-dimethyloct-6-en-3-imine?
The canonical SMILES for N-methoxy-4,7-dimethyloct-6-en-3-imine is CCC(=NOC)C(C)CC=C(C)C.
What is the InChIKey of N-methoxy-4,7-dimethyloct-6-en-3-imine?
The InChIKey is MZPHHSIAUHKATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-6-11(12-13-5)10(4)8-7-9(2)3/h7,10H,6,8H2,1-5H3.
What are the key properties of N-methoxy-4,7-dimethyloct-6-en-3-imine?
N-methoxy-4,7-dimethyloct-6-en-3-imine has a molecular weight of 183.29 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-4,7-dimethyloct-6-en-3-imine is sourced from PubChem (CID 54099560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).