C30H58N4O2 — CID 54099695
N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)decanediamide (PubChem CID 54099695) has the molecular formula C30H58N4O2 and a molecular weight of 506.82 g/mol. Its IUPAC name is N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)decanediamide.
| Compound Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)decanediamide |
|---|---|
| PubChem CID | 54099695 |
| Molecular Formula | C30H58N4O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.46 |
| IUPAC Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)decanediamide |
| SMILES | CN1C(C)(C)CC(NC(=O)CCCCCCCCC(=O)NC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C30H58N4O2/c1-27(2)19-23(20-28(3,4)33(27)9)31-25(35)17-15-13-11-12-14-16-18-26(36)32-24-21-29(5,6)34(10)30(7,8)22-24/h23-24H,11-22H2,1-10H3,(H,31,35)(H,32,36) |
| InChIKey | MZRPLRXHBYFFCS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|