About 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol
7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol (PubChem CID 54100099) has the molecular formula C11H19FOS2
and a molecular weight of 250.40 g/mol. Its IUPAC name is 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol.
Molecular Properties
| Compound Name | 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol |
| PubChem CID | 54100099 |
| Molecular Formula | C11H19FOS2 |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol |
| SMILES | OCCCCC(F)=CCC1SCCCS1 |
| InChI | InChI=1S/C11H19FOS2/c12-10(4-1-2-7-13)5-6-11-14-8-3-9-15-11/h5,11,13H,1-4,6-9H2 |
| InChIKey | MZYHMSPUUAAULV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol?
The IUPAC name of 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol (CID 54100099) is 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol.
What is the SMILES notation for 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol?
The canonical SMILES for 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol is OCCCCC(F)=CCC1SCCCS1.
What is the InChIKey of 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol?
The InChIKey is MZYHMSPUUAAULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FOS2/c12-10(4-1-2-7-13)5-6-11-14-8-3-9-15-11/h5,11,13H,1-4,6-9H2.
What are the key properties of 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol?
7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol has a molecular weight of 250.40 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,3-dithian-2-yl)-5-fluorohept-5-en-1-ol is sourced from PubChem (CID 54100099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).