C24H22O8 — CID 54100484
bis[(2,4-diacetylphenyl)methyl] oxalate (PubChem CID 54100484) has the molecular formula C24H22O8 and a molecular weight of 438.43 g/mol. Its IUPAC name is bis[(2,4-diacetylphenyl)methyl] oxalate.
| Compound Name | bis[(2,4-diacetylphenyl)methyl] oxalate |
|---|---|
| PubChem CID | 54100484 |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | bis[(2,4-diacetylphenyl)methyl] oxalate |
| SMILES | CC(=O)c1ccc(COC(=O)C(=O)OCc2ccc(C(C)=O)cc2C(C)=O)c(C(C)=O)c1 |
| InChI | InChI=1S/C24H22O8/c1-13(25)17-5-7-19(21(9-17)15(3)27)11-31-23(29)24(30)32-12-20-8-6-18(14(2)26)10-22(20)16(4)28/h5-10H,11-12H2,1-4H3 |
| InChIKey | NAENRQSBCVGLJU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|