C36H66F6O3Si3 — CID 54100683
[12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodeca-3,10-dien-2-yl]oxy-trimethylsilane (PubChem CID 54100683) has the molecular formula C36H66F6O3Si3 and a molecular weight of 745.17 g/mol. Its IUPAC name is [12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodeca-3,10-dien-2-yl]oxy-trimethylsilane.
| Compound Name | [12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodeca-3,10-dien-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 54100683 |
| Molecular Formula | C36H66F6O3Si3 |
| Molecular Weight | 745.17 g/mol |
| Exact Mass | 744.42 |
| IUPAC Name | [12-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]-1,1,1-trifluoro-6,6-dimethyl-2-(trifluoromethyl)dodeca-3,10-dien-2-yl]oxy-trimethylsilane |
| SMILES | CC(C)(CC=CC(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)CCCC=CC=C1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C36H66F6O3Si3/c1-31(2,3)47(12,13)43-29-25-28(26-30(27-29)44-48(14,15)32(4,5)6)21-18-16-17-19-22-33(7,8)23-20-24-34(35(37,38)39,36(40,41)42)45-46(9,10)11/h16,18,20-21,24,29-30H,17,19,22-23,25-27H2,1-15H3/t29-,30-/m1/s1 |
| InChIKey | NAHLXJPCSMULBV-LOYHVIPDSA-N |
| XLogP | 13.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.17 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|