C7H7Cl2F3O2 — CID 54100955
4,4-dichloro-1-ethoxy-5,5,5-trifluoropent-1-en-3-one (PubChem CID 54100955) has the molecular formula C7H7Cl2F3O2 and a molecular weight of 251.03 g/mol. Its IUPAC name is 4,4-dichloro-1-ethoxy-5,5,5-trifluoropent-1-en-3-one.
| Compound Name | 4,4-dichloro-1-ethoxy-5,5,5-trifluoropent-1-en-3-one |
|---|---|
| PubChem CID | 54100955 |
| Molecular Formula | C7H7Cl2F3O2 |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 4,4-dichloro-1-ethoxy-5,5,5-trifluoropent-1-en-3-one |
| SMILES | CCOC=CC(=O)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C7H7Cl2F3O2/c1-2-14-4-3-5(13)6(8,9)7(10,11)12/h3-4H,2H2,1H3 |
| InChIKey | NALYMGIZUJLVOC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|