C20H18F3N3OS — CID 54102757
N-(2,4-difluorophenyl)-N-[5-(4-fluorophenyl)sulfanyl-1-methyl-3-propylpyrazol-4-yl]formamide (PubChem CID 54102757) has the molecular formula C20H18F3N3OS and a molecular weight of 405.45 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-[5-(4-fluorophenyl)sulfanyl-1-methyl-3-propylpyrazol-4-yl]formamide.
| Compound Name | N-(2,4-difluorophenyl)-N-[5-(4-fluorophenyl)sulfanyl-1-methyl-3-propylpyrazol-4-yl]formamide |
|---|---|
| PubChem CID | 54102757 |
| Molecular Formula | C20H18F3N3OS |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-[5-(4-fluorophenyl)sulfanyl-1-methyl-3-propylpyrazol-4-yl]formamide |
| SMILES | CCCc1nn(C)c(Sc2ccc(F)cc2)c1N(C=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H18F3N3OS/c1-3-4-17-19(26(12-27)18-10-7-14(22)11-16(18)23)20(25(2)24-17)28-15-8-5-13(21)6-9-15/h5-12H,3-4H2,1-2H3 |
| InChIKey | NBQSVSWSCHGYJA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|