C30H29N5O4 — CID 54102917
N-[3-[[1-(2-cyclopentyl-2-oxoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoylamino]phenyl]formamide (PubChem CID 54102917) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is N-[3-[[1-(2-cyclopentyl-2-oxoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoylamino]phenyl]formamide.
| Compound Name | N-[3-[[1-(2-cyclopentyl-2-oxoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoylamino]phenyl]formamide |
|---|---|
| PubChem CID | 54102917 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | N-[3-[[1-(2-cyclopentyl-2-oxoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamoylamino]phenyl]formamide |
| SMILES | O=CNc1cccc(NC(=O)NC2N=C(c3ccccc3)c3ccccc3N(CC(=O)C3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C30H29N5O4/c36-19-31-22-13-8-14-23(17-22)32-30(39)34-28-29(38)35(18-26(37)20-9-4-5-10-20)25-16-7-6-15-24(25)27(33-28)21-11-2-1-3-12-21/h1-3,6-8,11-17,19-20,28H,4-5,9-10,18H2,(H,31,36)(H2,32,34,39) |
| InChIKey | NBTPBXRVDJHTCX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|