C10H11Cl2N — CID 54102922
5,6-dichloro-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 54102922) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is 5,6-dichloro-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 5,6-dichloro-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 54102922 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 5,6-dichloro-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | NC1CCc2c(ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C10H11Cl2N/c11-9-4-1-6-5-7(13)2-3-8(6)10(9)12/h1,4,7H,2-3,5,13H2 |
| InChIKey | NBTRHBARHPXSCA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |