C42H36N8O2 — CID 54102949
methyl 5-amino-3-[1,2,2-tris(5-amino-1H-indol-3-yl)-1-phenylethyl]-1H-indole-4-carboxylate (PubChem CID 54102949) has the molecular formula C42H36N8O2 and a molecular weight of 684.80 g/mol. Its IUPAC name is methyl 5-amino-3-[1,2,2-tris(5-amino-1H-indol-3-yl)-1-phenylethyl]-1H-indole-4-carboxylate.
| Compound Name | methyl 5-amino-3-[1,2,2-tris(5-amino-1H-indol-3-yl)-1-phenylethyl]-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 54102949 |
| Molecular Formula | C42H36N8O2 |
| Molecular Weight | 684.80 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | methyl 5-amino-3-[1,2,2-tris(5-amino-1H-indol-3-yl)-1-phenylethyl]-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1c(N)ccc2[nH]cc(C(c3ccccc3)(c3c[nH]c4ccc(N)cc34)C(c3c[nH]c4ccc(N)cc34)c3c[nH]c4ccc(N)cc34)c12 |
| InChI | InChI=1S/C42H36N8O2/c1-52-41(51)39-33(46)10-14-37-38(39)32(21-50-37)42(22-5-3-2-4-6-22,31-20-49-36-13-9-25(45)17-28(31)36)40(29-18-47-34-11-7-23(43)15-26(29)34)30-19-48-35-12-8-24(44)16-27(30)35/h2-21,40,47-50H,43-46H2,1H3 |
| InChIKey | NBTZVSOAQXYFOL-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 193.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.80 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|