C17H18FN5O — CID 54103637
(2-fluorophenyl)-[3-(propan-2-yldiazenyl)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]methanone (PubChem CID 54103637) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is (2-fluorophenyl)-[3-(propan-2-yldiazenyl)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]methanone.
| Compound Name | (2-fluorophenyl)-[3-(propan-2-yldiazenyl)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]methanone |
|---|---|
| PubChem CID | 54103637 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2-fluorophenyl)-[3-(propan-2-yldiazenyl)-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl]methanone |
| SMILES | CC(C)/N=N/c1cc2c(nn1)CCN(C(=O)c1ccccc1F)C2 |
| InChI | InChI=1S/C17H18FN5O/c1-11(2)19-21-16-9-12-10-23(8-7-15(12)20-22-16)17(24)13-5-3-4-6-14(13)18/h3-6,9,11H,7-8,10H2,1-2H3/b21-19+ |
| InChIKey | NCFMCXOUVQNGRG-XUTLUUPISA-N |
| XLogP | 3.31 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|