About 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione
4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione (PubChem CID 54104285) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione.
Molecular Properties
| Compound Name | 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione |
| PubChem CID | 54104285 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione |
| SMILES | CC1C(=O)CC(CC2CC(=O)NC(=O)C2)OC1=O |
| InChI | InChI=1S/C12H15NO5/c1-6-9(14)5-8(18-12(6)17)2-7-3-10(15)13-11(16)4-7/h6-8H,2-5H2,1H3,(H,13,15,16) |
| InChIKey | NCQJQKZQGPVDCW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione?
The IUPAC name of 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione (CID 54104285) is 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione.
What is the SMILES notation for 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione?
The canonical SMILES for 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione is CC1C(=O)CC(CC2CC(=O)NC(=O)C2)OC1=O.
What is the InChIKey of 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione?
The InChIKey is NCQJQKZQGPVDCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO5/c1-6-9(14)5-8(18-12(6)17)2-7-3-10(15)13-11(16)4-7/h6-8H,2-5H2,1H3,(H,13,15,16).
What are the key properties of 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione?
4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione has a molecular weight of 253.25 g/mol, XLogP of -0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-4,6-dioxooxan-2-yl)methyl]piperidine-2,6-dione is sourced from PubChem (CID 54104285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).