C26H37NO4 — CID 54104330
8,8,12,16-tetramethyl-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 54104330) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is 8,8,12,16-tetramethyl-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 8,8,12,16-tetramethyl-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 54104330 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 8,8,12,16-tetramethyl-3-(2-pyridin-2-ylethenyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CCCC2(C)OC2CC(C=Cc2ccccn2)OC(=O)CCC(C)(C)C(=O)CC1 |
| InChI | InChI=1S/C26H37NO4/c1-19-8-7-15-26(4)23(31-26)18-21(12-11-20-9-5-6-17-27-20)30-24(29)14-16-25(2,3)22(28)13-10-19/h5-6,9,11-12,17,19,21,23H,7-8,10,13-16,18H2,1-4H3 |
| InChIKey | NCRBCASDCUMKMW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 68.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|