About 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol
3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol (PubChem CID 54104804) has the molecular formula C18H15N3O2
and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol.
Molecular Properties
| Compound Name | 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol |
| PubChem CID | 54104804 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol |
| SMILES | Oc1cccc(-c2cc(-c3ccc(C4=NCCN4)cc3)no2)c1 |
| InChI | InChI=1S/C18H15N3O2/c22-15-3-1-2-14(10-15)17-11-16(21-23-17)12-4-6-13(7-5-12)18-19-8-9-20-18/h1-7,10-11,22H,8-9H2,(H,19,20) |
| InChIKey | NCZJRDLVDHEYPB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol?
The IUPAC name of 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol (CID 54104804) is 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol.
What is the SMILES notation for 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol?
The canonical SMILES for 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol is Oc1cccc(-c2cc(-c3ccc(C4=NCCN4)cc3)no2)c1.
What is the InChIKey of 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol?
The InChIKey is NCZJRDLVDHEYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2/c22-15-3-1-2-14(10-15)17-11-16(21-23-17)12-4-6-13(7-5-12)18-19-8-9-20-18/h1-7,10-11,22H,8-9H2,(H,19,20).
What are the key properties of 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol?
3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol has a molecular weight of 305.34 g/mol, XLogP of 3.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-oxazol-5-yl]phenol is sourced from PubChem (CID 54104804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).