C19H21ClN2O3 — CID 54105155
1-(4-chlorobut-2-enyl)-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione (PubChem CID 54105155) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 1-(4-chlorobut-2-enyl)-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-(4-chlorobut-2-enyl)-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54105155 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-(4-chlorobut-2-enyl)-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1c(C(=O)c2cc(C)cc(C)c2)n(CC=CCCl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H21ClN2O3/c1-4-15-16(17(23)14-10-12(2)9-13(3)11-14)22(8-6-5-7-20)19(25)21-18(15)24/h5-6,9-11H,4,7-8H2,1-3H3,(H,21,24,25) |
| InChIKey | NDFPPDBTHLGMNY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|