C10H9ClO2S — CID 54105806
3,4-dihydronaphthalene-1-sulfonyl chloride (PubChem CID 54105806) has the molecular formula C10H9ClO2S and a molecular weight of 228.70 g/mol. Its IUPAC name is 3,4-dihydronaphthalene-1-sulfonyl chloride.
| Compound Name | 3,4-dihydronaphthalene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 54105806 |
| Molecular Formula | C10H9ClO2S |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 3,4-dihydronaphthalene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1=CCCc2ccccc21 |
| InChI | InChI=1S/C10H9ClO2S/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6-7H,3,5H2 |
| InChIKey | NDRDJMFRANXMGB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |