C25H19NO10 — CID 541061
[1-(2-acetamido-2-oxoethyl)-12-acetyloxy-3,6,11-trioxo-1,4-dihydronaphtho[6,7-g]isochromen-10-yl] acetate (PubChem CID 541061) has the molecular formula C25H19NO10 and a molecular weight of 493.42 g/mol. Its IUPAC name is [1-(2-acetamido-2-oxoethyl)-12-acetyloxy-3,6,11-trioxo-1,4-dihydronaphtho[6,7-g]isochromen-10-yl] acetate.
| Compound Name | [1-(2-acetamido-2-oxoethyl)-12-acetyloxy-3,6,11-trioxo-1,4-dihydronaphtho[6,7-g]isochromen-10-yl] acetate |
|---|---|
| PubChem CID | 541061 |
| Molecular Formula | C25H19NO10 |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | [1-(2-acetamido-2-oxoethyl)-12-acetyloxy-3,6,11-trioxo-1,4-dihydronaphtho[6,7-g]isochromen-10-yl] acetate |
| SMILES | CC(=O)NC(=O)CC1OC(=O)Cc2cc3c(c(OC(C)=O)c21)C(=O)c1c(OC(C)=O)cccc1C3=O |
| InChI | InChI=1S/C25H19NO10/c1-10(27)26-18(30)9-17-20-13(8-19(31)36-17)7-15-22(25(20)35-12(3)29)24(33)21-14(23(15)32)5-4-6-16(21)34-11(2)28/h4-7,17H,8-9H2,1-3H3,(H,26,27,30) |
| InChIKey | ZUQBNLZRIPHDOJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 159.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|