About methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate
methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate (PubChem CID 54106368) has the molecular formula C20H32O5
and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate.
Molecular Properties
| Compound Name | methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate |
| PubChem CID | 54106368 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate |
| SMILES | COC(=O)C(CC=C(C)CCC=C(C)COC1CCCCO1)C(C)=O |
| InChI | InChI=1S/C20H32O5/c1-15(11-12-18(17(3)21)20(22)23-4)8-7-9-16(2)14-25-19-10-5-6-13-24-19/h9,11,18-19H,5-8,10,12-14H2,1-4H3 |
| InChIKey | NEARTNVEKBLUHG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate?
The IUPAC name of methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate (CID 54106368) is methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate.
What is the SMILES notation for methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate?
The canonical SMILES for methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate is COC(=O)C(CC=C(C)CCC=C(C)COC1CCCCO1)C(C)=O.
What is the InChIKey of methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate?
The InChIKey is NEARTNVEKBLUHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O5/c1-15(11-12-18(17(3)21)20(22)23-4)8-7-9-16(2)14-25-19-10-5-6-13-24-19/h9,11,18-19H,5-8,10,12-14H2,1-4H3.
What are the key properties of methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate?
methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate has a molecular weight of 352.47 g/mol, XLogP of 3.97, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate is sourced from PubChem (CID 54106368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).