C17H22O4 — CID 54106373
[3,5,5-trimethyl-4-(3-methyl-5-oxopenta-1,3-dienyl)-2-oxocyclohex-3-en-1-yl] acetate (PubChem CID 54106373) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [3,5,5-trimethyl-4-(3-methyl-5-oxopenta-1,3-dienyl)-2-oxocyclohex-3-en-1-yl] acetate.
| Compound Name | [3,5,5-trimethyl-4-(3-methyl-5-oxopenta-1,3-dienyl)-2-oxocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 54106373 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [3,5,5-trimethyl-4-(3-methyl-5-oxopenta-1,3-dienyl)-2-oxocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)OC1CC(C)(C)C(C=CC(C)=CC=O)=C(C)C1=O |
| InChI | InChI=1S/C17H22O4/c1-11(8-9-18)6-7-14-12(2)16(20)15(21-13(3)19)10-17(14,4)5/h6-9,15H,10H2,1-5H3 |
| InChIKey | NEAUDHZUTJWTPZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|