C20H25N3O5 — CID 54106825
4-O-(5-carbamoyl-1H-imidazol-4-yl) 1-O-octyl benzene-1,4-dicarboxylate (PubChem CID 54106825) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-O-(5-carbamoyl-1H-imidazol-4-yl) 1-O-octyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(5-carbamoyl-1H-imidazol-4-yl) 1-O-octyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 54106825 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-O-(5-carbamoyl-1H-imidazol-4-yl) 1-O-octyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1ccc(C(=O)Oc2nc[nH]c2C(N)=O)cc1 |
| InChI | InChI=1S/C20H25N3O5/c1-2-3-4-5-6-7-12-27-19(25)14-8-10-15(11-9-14)20(26)28-18-16(17(21)24)22-13-23-18/h8-11,13H,2-7,12H2,1H3,(H2,21,24)(H,22,23) |
| InChIKey | NEIFGDHLORBTOW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|