About 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol
7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol (PubChem CID 54106882) has the molecular formula C20H38O
and a molecular weight of 294.52 g/mol. Its IUPAC name is 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol.
Molecular Properties
| Compound Name | 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol |
| PubChem CID | 54106882 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CCCCCCCO |
| InChI | InChI=1S/C20H38O/c1-2-3-4-5-7-10-14-19-16-13-17-20(19)15-11-8-6-9-12-18-21/h10,14,19-21H,2-9,11-13,15-18H2,1H3/t19-,20-/m0/s1 |
| InChIKey | NEJBDGMJSZMCQF-PMACEKPBSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol?
The IUPAC name of 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol (CID 54106882) is 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol.
What is the SMILES notation for 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol?
The canonical SMILES for 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol is CCCCCCC=C[C@H]1CCC[C@@H]1CCCCCCCO.
What is the InChIKey of 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol?
The InChIKey is NEJBDGMJSZMCQF-PMACEKPBSA-N. The full InChI is InChI=1S/C20H38O/c1-2-3-4-5-7-10-14-19-16-13-17-20(19)15-11-8-6-9-12-18-21/h10,14,19-21H,2-9,11-13,15-18H2,1H3/t19-,20-/m0/s1.
What are the key properties of 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol?
7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol has a molecular weight of 294.52 g/mol, XLogP of 6.26, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptan-1-ol is sourced from PubChem (CID 54106882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).