C28H41N5O7 — CID 54107220
N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-3,4,5-trimethoxybenzamide (PubChem CID 54107220) has the molecular formula C28H41N5O7 and a molecular weight of 559.66 g/mol. Its IUPAC name is N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 54107220 |
| Molecular Formula | C28H41N5O7 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(O)CCCCCCCCCn2c(=O)c3c(ncn3C)n(C)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C28H41N5O7/c1-31-18-30-25-23(31)27(36)33(28(37)32(25)2)14-12-10-8-6-7-9-11-13-20(34)17-29-26(35)19-15-21(38-3)24(40-5)22(16-19)39-4/h15-16,18,20,34H,6-14,17H2,1-5H3,(H,29,35) |
| InChIKey | QULXAYXVLSFSJS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|