C11H7F9O — CID 541073
1-[3,5,6-tris(trifluoromethyl)cyclohexa-1,4-dien-1-yl]ethanone (PubChem CID 541073) has the molecular formula C11H7F9O and a molecular weight of 326.16 g/mol. Its IUPAC name is 1-[3,5,6-tris(trifluoromethyl)cyclohexa-1,4-dien-1-yl]ethanone.
| Compound Name | 1-[3,5,6-tris(trifluoromethyl)cyclohexa-1,4-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 541073 |
| Molecular Formula | C11H7F9O |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-[3,5,6-tris(trifluoromethyl)cyclohexa-1,4-dien-1-yl]ethanone |
| SMILES | CC(=O)C1=CC(C(F)(F)F)C=C(C(F)(F)F)C1C(F)(F)F |
| InChI | InChI=1S/C11H7F9O/c1-4(21)6-2-5(9(12,13)14)3-7(10(15,16)17)8(6)11(18,19)20/h2-3,5,8H,1H3 |
| InChIKey | PSANNOUCHBNOPQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|