C18H4Br8N2O4 — CID 54107511
4,5,6,7-tetrabromo-2-[1-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 54107511) has the molecular formula C18H4Br8N2O4 and a molecular weight of 951.47 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-2-[1-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrabromo-2-[1-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54107511 |
| Molecular Formula | C18H4Br8N2O4 |
| Molecular Weight | 951.47 g/mol |
| Exact Mass | 943.36 |
| IUPAC Name | 4,5,6,7-tetrabromo-2-[1-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | CC(N1C(=O)c2c(Br)c(Br)c(Br)c(Br)c2C1=O)N1C(=O)c2c(Br)c(Br)c(Br)c(Br)c2C1=O |
| InChI | InChI=1S/C18H4Br8N2O4/c1-2(27-15(29)3-4(16(27)30)8(20)12(24)11(23)7(3)19)28-17(31)5-6(18(28)32)10(22)14(26)13(25)9(5)21/h2H,1H3 |
| InChIKey | NEUHYMIDXNTABG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.47 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|