C27H32N2O8S — CID 54107615
(2S)-2-anilino-2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)sulfanylpropanoyl]amino]pentanedioic acid (PubChem CID 54107615) has the molecular formula C27H32N2O8S and a molecular weight of 544.63 g/mol. Its IUPAC name is (2S)-2-anilino-2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)sulfanylpropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-anilino-2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)sulfanylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 54107615 |
| Molecular Formula | C27H32N2O8S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | (2S)-2-anilino-2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)sulfanylpropanoyl]amino]pentanedioic acid |
| SMILES | CC1(C)OCC(C(=O)SCC(Cc2ccccc2)C(=O)N[C@](CCC(=O)O)(Nc2ccccc2)C(=O)O)O1 |
| InChI | InChI=1S/C27H32N2O8S/c1-26(2)36-16-21(37-26)24(33)38-17-19(15-18-9-5-3-6-10-18)23(32)29-27(25(34)35,14-13-22(30)31)28-20-11-7-4-8-12-20/h3-12,19,21,28H,13-17H2,1-2H3,(H,29,32)(H,30,31)(H,34,35)/t19?,21?,27-/m0/s1 |
| InChIKey | NEWCUAROGPTICL-GASOQUEOSA-N |
| XLogP | 3.13 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|