About N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide
N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide (PubChem CID 5410787) has the molecular formula C16H20N4O2
and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide.
Molecular Properties
| Compound Name | N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide |
| PubChem CID | 5410787 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide |
| SMILES | CCn1nc(C)c(/C=N\NC(=O)c2cccc(OC)c2)c1C |
| InChI | InChI=1S/C16H20N4O2/c1-5-20-12(3)15(11(2)19-20)10-17-18-16(21)13-7-6-8-14(9-13)22-4/h6-10H,5H2,1-4H3,(H,18,21)/b17-10- |
| InChIKey | YPMYAACWUFNTEB-YVLHZVERSA-N |
| XLogP | 2.29 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide?
The IUPAC name of N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide (CID 5410787) is N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide.
What is the SMILES notation for N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide?
The canonical SMILES for N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide is CCn1nc(C)c(/C=N\NC(=O)c2cccc(OC)c2)c1C.
What is the InChIKey of N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide?
The InChIKey is YPMYAACWUFNTEB-YVLHZVERSA-N. The full InChI is InChI=1S/C16H20N4O2/c1-5-20-12(3)15(11(2)19-20)10-17-18-16(21)13-7-6-8-14(9-13)22-4/h6-10H,5H2,1-4H3,(H,18,21)/b17-10-.
What are the key properties of N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide?
N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide has a molecular weight of 300.36 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-methoxybenzamide is sourced from PubChem (CID 5410787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).