About 3-diazocyclopenta-1,4-diene-1-carbaldehyde
3-diazocyclopenta-1,4-diene-1-carbaldehyde (PubChem CID 54108222) has the molecular formula C6H4N2O
and a molecular weight of 120.11 g/mol. Its IUPAC name is 3-diazocyclopenta-1,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-diazocyclopenta-1,4-diene-1-carbaldehyde |
| PubChem CID | 54108222 |
| Molecular Formula | C6H4N2O |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | 3-diazocyclopenta-1,4-diene-1-carbaldehyde |
| SMILES | [N-]=[N+]=C1C=CC(C=O)=C1 |
| InChI | InChI=1S/C6H4N2O/c7-8-6-2-1-5(3-6)4-9/h1-4H |
| InChIKey | GEJXEWMTFDNEJZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-diazocyclopenta-1,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazocyclopenta-1,4-diene-1-carbaldehyde?
The IUPAC name of 3-diazocyclopenta-1,4-diene-1-carbaldehyde (CID 54108222) is 3-diazocyclopenta-1,4-diene-1-carbaldehyde.
What is the SMILES notation for 3-diazocyclopenta-1,4-diene-1-carbaldehyde?
The canonical SMILES for 3-diazocyclopenta-1,4-diene-1-carbaldehyde is [N-]=[N+]=C1C=CC(C=O)=C1.
What is the InChIKey of 3-diazocyclopenta-1,4-diene-1-carbaldehyde?
The InChIKey is GEJXEWMTFDNEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O/c7-8-6-2-1-5(3-6)4-9/h1-4H.
What are the key properties of 3-diazocyclopenta-1,4-diene-1-carbaldehyde?
3-diazocyclopenta-1,4-diene-1-carbaldehyde has a molecular weight of 120.11 g/mol, XLogP of 0.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazocyclopenta-1,4-diene-1-carbaldehyde is sourced from PubChem (CID 54108222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).