C28H35NO — CID 54108231
4,4-dimethyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]-5H-1,3-oxazole (PubChem CID 54108231) has the molecular formula C28H35NO and a molecular weight of 401.59 g/mol. Its IUPAC name is 4,4-dimethyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 54108231 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 4,4-dimethyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]-5H-1,3-oxazole |
| SMILES | CC(=Cc1ccc(C2=NC(C)(C)CO2)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H35NO/c1-19(16-20-8-10-21(11-9-20)25-29-28(6,7)18-30-25)22-12-13-23-24(17-22)27(4,5)15-14-26(23,2)3/h8-13,16-17H,14-15,18H2,1-7H3 |
| InChIKey | NFGLQRKBYMMHHQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|