C12H17NO3 — CID 54108390
ethyl 2-[(3aS,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetate (PubChem CID 54108390) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is ethyl 2-[(3aS,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetate.
| Compound Name | ethyl 2-[(3aS,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetate |
|---|---|
| PubChem CID | 54108390 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | ethyl 2-[(3aS,7aS)-2-oxo-3a,4,5,7a-tetrahydro-3H-indol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C[C@@H]2CCC=C[C@H]21 |
| InChI | InChI=1S/C12H17NO3/c1-2-16-12(15)8-13-10-6-4-3-5-9(10)7-11(13)14/h4,6,9-10H,2-3,5,7-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | NFIXQUNYHGCMKU-VHSXEESVSA-N |
| XLogP | 1.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|