C18H36O4S — CID 54108858
4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid (PubChem CID 54108858) has the molecular formula C18H36O4S and a molecular weight of 348.55 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid.
| Compound Name | 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid |
|---|---|
| PubChem CID | 54108858 |
| Molecular Formula | C18H36O4S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid |
| SMILES | CCCCCCCCCC(SCC(O)CO)C(CC)CC(=O)O |
| InChI | InChI=1S/C18H36O4S/c1-3-5-6-7-8-9-10-11-17(23-14-16(20)13-19)15(4-2)12-18(21)22/h15-17,19-20H,3-14H2,1-2H3,(H,21,22) |
| InChIKey | NFQVFCSJHOLYEG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|