4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid

C18H36O4S — CID 54108858

IUPAC4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid
SMILESCCCCCCCCCC(SCC(O)CO)C(CC)CC(=O)O
InChIInChI=1S/C18H36O4S/c1-3-5-6-7-8-9-10-11-17(23-14-16(20)13-19)15(4-2)12-18(21)22/h15-17,19-20H,3-14H2,1-2H3,(H,21,22)
InChIKeyNFQVFCSJHOLYEG-UHFFFAOYSA-N
MW348.55 g/mol
LogP4.08
Rot. Bonds16

About 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid

4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid (PubChem CID 54108858) has the molecular formula C18H36O4S and a molecular weight of 348.55 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid.

Molecular Properties

Compound Name4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid
PubChem CID54108858
Molecular FormulaC18H36O4S
Molecular Weight348.55 g/mol
Exact Mass348.23
IUPAC Name4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid
SMILESCCCCCCCCCC(SCC(O)CO)C(CC)CC(=O)O
InChIInChI=1S/C18H36O4S/c1-3-5-6-7-8-9-10-11-17(23-14-16(20)13-19)15(4-2)12-18(21)22/h15-17,19-20H,3-14H2,1-2H3,(H,21,22)
InChIKeyNFQVFCSJHOLYEG-UHFFFAOYSA-N
XLogP4.08
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds16
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.55
LogP ≤ 54.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid?
The IUPAC name of 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid (CID 54108858) is 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid.
What is the SMILES notation for 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid?
The canonical SMILES for 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid is CCCCCCCCCC(SCC(O)CO)C(CC)CC(=O)O.
What is the InChIKey of 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid?
The InChIKey is NFQVFCSJHOLYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O4S/c1-3-5-6-7-8-9-10-11-17(23-14-16(20)13-19)15(4-2)12-18(21)22/h15-17,19-20H,3-14H2,1-2H3,(H,21,22).
What are the key properties of 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid?
4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid has a molecular weight of 348.55 g/mol, XLogP of 4.08, 16 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydroxypropylsulfanyl)-3-ethyltridecanoic acid is sourced from PubChem (CID 54108858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).