C30H42O20 — CID 54108974
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexoxy]oxan-2-yl]methyl acetate (PubChem CID 54108974) has the molecular formula C30H42O20 and a molecular weight of 722.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54108974 |
| Molecular Formula | C30H42O20 |
| Molecular Weight | 722.65 g/mol |
| Exact Mass | 722.23 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C30H42O20/c1-13(31)40-10-22(43-15(3)33)25(45-17(5)35)26(46-18(6)36)23(44-16(4)34)12-42-30-29(49-21(9)39)28(48-20(8)38)27(47-19(7)37)24(50-30)11-41-14(2)32/h22-30H,10-12H2,1-9H3/t22-,23-,24-,25-,26-,27-,28+,29-,30?/m1/s1 |
| InChIKey | NFSSSVMQHKPQSO-CAMNXGIXSA-N |
| XLogP | -0.62 |
| TPSA | 255.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.65 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|