About 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal
3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal (PubChem CID 54109257) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal |
| PubChem CID | 54109257 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO3/c1-9(2,6-11)5-10-7(12)3-4-8(10)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | KOVAGZKDRMONGM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal (CID 54109257) is 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal is CC(C)(C=O)CN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal?
The InChIKey is KOVAGZKDRMONGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-9(2,6-11)5-10-7(12)3-4-8(10)13/h3-4,6H,5H2,1-2H3.
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal?
3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal has a molecular weight of 181.19 g/mol, XLogP of 0.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)-2,2-dimethylpropanal is sourced from PubChem (CID 54109257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).