C30H20I8N2O7 — CID 54109286
(2S)-3-[4-[4-[(2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoyl]oxyphenoxy]phenyl]-2-(diiodoamino)-2,3-diiodopropanoic acid (PubChem CID 54109286) has the molecular formula C30H20I8N2O7 and a molecular weight of 1535.73 g/mol. Its IUPAC name is (2S)-3-[4-[4-[(2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoyl]oxyphenoxy]phenyl]-2-(diiodoamino)-2,3-diiodopropanoic acid.
| Compound Name | (2S)-3-[4-[4-[(2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoyl]oxyphenoxy]phenyl]-2-(diiodoamino)-2,3-diiodopropanoic acid |
|---|---|
| PubChem CID | 54109286 |
| Molecular Formula | C30H20I8N2O7 |
| Molecular Weight | 1535.73 g/mol |
| Exact Mass | 1535.36 |
| IUPAC Name | (2S)-3-[4-[4-[(2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoyl]oxyphenoxy]phenyl]-2-(diiodoamino)-2,3-diiodopropanoic acid |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)Oc1ccc(Oc2ccc(C(I)[C@@](I)(C(=O)O)N(I)I)cc2)cc1 |
| InChI | InChI=1S/C30H20I8N2O7/c31-20-12-19(13-21(32)25(20)41)46-26-22(33)9-14(10-23(26)34)11-24(39)28(42)47-18-7-5-17(6-8-18)45-16-3-1-15(2-4-16)27(35)30(36,29(43)44)40(37)38/h1-10,12-13,24,27,41H,11,39H2,(H,43,44)/t24-,27?,30-/m0/s1 |
| InChIKey | NFYBWSACMXSDTO-ZELULNAYSA-N |
| XLogP | 10.56 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1535.73 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|