C17H12Cl4F4N4O3S — CID 54109430
N-[3-cyano-4-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-2-(2-methoxyethoxy)acetamide (PubChem CID 54109430) has the molecular formula C17H12Cl4F4N4O3S and a molecular weight of 570.18 g/mol. Its IUPAC name is N-[3-cyano-4-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[3-cyano-4-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 54109430 |
| Molecular Formula | C17H12Cl4F4N4O3S |
| Molecular Weight | 570.18 g/mol |
| Exact Mass | 567.93 |
| IUPAC Name | N-[3-cyano-4-[dichloro(fluoro)methyl]sulfanyl-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1c(SC(F)(Cl)Cl)c(C#N)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H12Cl4F4N4O3S/c1-31-2-3-32-7-12(30)27-15-14(33-17(20,21)25)11(6-26)28-29(15)13-9(18)4-8(5-10(13)19)16(22,23)24/h4-5H,2-3,7H2,1H3,(H,27,30) |
| InChIKey | NGALOQIVHJHYRL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.18 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|