C24H41NOSi — CID 54109504
(4-tert-butylphenyl)methyl-cyclohexyl-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-methylsilane (PubChem CID 54109504) has the molecular formula C24H41NOSi and a molecular weight of 387.68 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl-cyclohexyl-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-methylsilane.
| Compound Name | (4-tert-butylphenyl)methyl-cyclohexyl-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-methylsilane |
|---|---|
| PubChem CID | 54109504 |
| Molecular Formula | C24H41NOSi |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | (4-tert-butylphenyl)methyl-cyclohexyl-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-methylsilane |
| SMILES | C[C@@H]1CN([Si](C)(Cc2ccc(C(C)(C)C)cc2)C2CCCCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C24H41NOSi/c1-19-16-25(17-20(2)26-19)27(6,23-10-8-7-9-11-23)18-21-12-14-22(15-13-21)24(3,4)5/h12-15,19-20,23H,7-11,16-18H2,1-6H3/t19-,20+,27? |
| InChIKey | NGBYAWFWBZHTKI-NNJHRLFQSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|